C35H32N2O6 — CID 4151079
2,8-dibenzyl-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4151079) has the molecular formula C35H32N2O6 and a molecular weight of 576.65 g/mol. Its IUPAC name is 2,8-dibenzyl-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-dibenzyl-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4151079 |
| Molecular Formula | C35H32N2O6 |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 576.23 |
| IUPAC Name | 2,8-dibenzyl-6-(4-hydroxy-2-methoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(O)ccc1C1C2=CCC3C(=O)N(Cc4ccccc4)C(=O)C3C2CC2C(=O)N(Cc3ccccc3)C(=O)C21 |
| InChI | InChI=1S/C35H32N2O6/c1-43-28-16-22(38)12-13-24(28)29-23-14-15-25-30(34(41)36(32(25)39)18-20-8-4-2-5-9-20)26(23)17-27-31(29)35(42)37(33(27)40)19-21-10-6-3-7-11-21/h2-14,16,25-27,29-31,38H,15,17-19H2,1H3 |
| InChIKey | VYCCYLNMMYVFEO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|