C29H28N2O6 — CID 4520022
6-(2-hydroxy-4-phenylmethoxyphenyl)-2,8-dimethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4520022) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is 6-(2-hydroxy-4-phenylmethoxyphenyl)-2,8-dimethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(2-hydroxy-4-phenylmethoxyphenyl)-2,8-dimethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4520022 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 6-(2-hydroxy-4-phenylmethoxyphenyl)-2,8-dimethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)C2CC=C3C(CC4C(=O)N(C)C(=O)C4C3c3ccc(OCc4ccccc4)cc3O)C2C1=O |
| InChI | InChI=1S/C29H28N2O6/c1-30-26(33)19-11-10-17-20(24(19)28(30)35)13-21-25(29(36)31(2)27(21)34)23(17)18-9-8-16(12-22(18)32)37-14-15-6-4-3-5-7-15/h3-10,12,19-21,23-25,32H,11,13-14H2,1-2H3 |
| InChIKey | LLUJEZDPRNKXKE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|