C43H28F12N2O6 — CID 3265068
2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3265068) has the molecular formula C43H28F12N2O6 and a molecular weight of 896.68 g/mol. Its IUPAC name is 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3265068 |
| Molecular Formula | C43H28F12N2O6 |
| Molecular Weight | 896.68 g/mol |
| Exact Mass | 896.18 |
| IUPAC Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(2-hydroxy-4-phenylmethoxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3c3ccc(OCc4ccccc4)cc3O)C2C(=O)N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C43H28F12N2O6/c44-40(45,46)20-10-21(41(47,48)49)13-24(12-20)56-36(59)29-9-8-27-30(34(29)38(56)61)17-31-35(33(27)28-7-6-26(16-32(28)58)63-18-19-4-2-1-3-5-19)39(62)57(37(31)60)25-14-22(42(50,51)52)11-23(15-25)43(53,54)55/h1-8,10-16,29-31,33-35,58H,9,17-18H2 |
| InChIKey | XASZNVXUBWSHIH-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.68 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|