C40H24F12N2O5 — CID 4151080
2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4151080) has the molecular formula C40H24F12N2O5 and a molecular weight of 840.62 g/mol. Its IUPAC name is 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4151080 |
| Molecular Formula | C40H24F12N2O5 |
| Molecular Weight | 840.62 g/mol |
| Exact Mass | 840.15 |
| IUPAC Name | 2,8-bis[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3c3ccc(O)c4ccccc34)C2C(=O)N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C40H24F12N2O5/c41-37(42,43)16-9-17(38(44,45)46)12-20(11-16)53-33(56)26-6-5-25-27(31(26)35(53)58)15-28-32(30(25)24-7-8-29(55)23-4-2-1-3-22(23)24)36(59)54(34(28)57)21-13-18(39(47,48)49)10-19(14-21)40(50,51)52/h1-5,7-14,26-28,30-32,55H,6,15H2 |
| InChIKey | KXIKJDJACSYADR-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.62 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|