C44H35BrN4O5 — CID 5063030
2,8-bis(4-anilinophenyl)-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5063030) has the molecular formula C44H35BrN4O5 and a molecular weight of 779.69 g/mol. Its IUPAC name is 2,8-bis(4-anilinophenyl)-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2,8-bis(4-anilinophenyl)-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5063030 |
| Molecular Formula | C44H35BrN4O5 |
| Molecular Weight | 779.69 g/mol |
| Exact Mass | 778.18 |
| IUPAC Name | 2,8-bis(4-anilinophenyl)-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)C4C3c3cc(Br)ccc3O)C2C(=O)N1c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C44H35BrN4O5/c45-25-11-22-37(50)35(23-25)38-32-20-21-33-39(43(53)48(41(33)51)30-16-12-28(13-17-30)46-26-7-3-1-4-8-26)34(32)24-36-40(38)44(54)49(42(36)52)31-18-14-29(15-19-31)47-27-9-5-2-6-10-27/h1-20,22-23,33-34,36,38-40,46-47,50H,21,24H2 |
| InChIKey | AOPPXAUVNQMQIT-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.69 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|