C28H33BrN2O5 — CID 3450232
6-(5-bromo-2-hydroxyphenyl)-2,8-ditert-butyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3450232) has the molecular formula C28H33BrN2O5 and a molecular weight of 557.49 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxyphenyl)-2,8-ditert-butyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxyphenyl)-2,8-ditert-butyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3450232 |
| Molecular Formula | C28H33BrN2O5 |
| Molecular Weight | 557.49 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 6-(5-bromo-2-hydroxyphenyl)-2,8-ditert-butyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC(C)(C)N1C(=O)C2CC=C3C(CC4C(=O)N(C(C)(C)C)C(=O)C4C3c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C28H33BrN2O5/c1-27(2,3)30-23(33)15-9-8-14-16(21(15)25(30)35)12-18-22(26(36)31(24(18)34)28(4,5)6)20(14)17-11-13(29)7-10-19(17)32/h7-8,10-11,15-16,18,20-22,32H,9,12H2,1-6H3 |
| InChIKey | FXNJOJIMCVIJJO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|