C24H25ClN2O5 — CID 5235634
6-(5-chloro-2-hydroxyphenyl)-2,8-diethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5235634) has the molecular formula C24H25ClN2O5 and a molecular weight of 456.93 g/mol. Its IUPAC name is 6-(5-chloro-2-hydroxyphenyl)-2,8-diethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-chloro-2-hydroxyphenyl)-2,8-diethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5235634 |
| Molecular Formula | C24H25ClN2O5 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-2,8-diethyl-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(CC4C(=O)N(CC)C(=O)C4C3c3cc(Cl)ccc3O)C2C1=O |
| InChI | InChI=1S/C24H25ClN2O5/c1-3-26-21(29)13-7-6-12-14(19(13)23(26)31)10-16-20(24(32)27(4-2)22(16)30)18(12)15-9-11(25)5-8-17(15)28/h5-6,8-9,13-14,16,18-20,28H,3-4,7,10H2,1-2H3 |
| InChIKey | RCQHRSJXPOSSOQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|