C26H25BrN2O9 — CID 3295970
3-[6-(5-bromo-2-hydroxyphenyl)-8-(2-carboxyethyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 3295970) has the molecular formula C26H25BrN2O9 and a molecular weight of 589.40 g/mol. Its IUPAC name is 3-[6-(5-bromo-2-hydroxyphenyl)-8-(2-carboxyethyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6-(5-bromo-2-hydroxyphenyl)-8-(2-carboxyethyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3295970 |
| Molecular Formula | C26H25BrN2O9 |
| Molecular Weight | 589.40 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | 3-[6-(5-bromo-2-hydroxyphenyl)-8-(2-carboxyethyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2CC=C3C(CC4C(=O)N(CCC(=O)O)C(=O)C4C3c3cc(Br)ccc3O)C2C1=O |
| InChI | InChI=1S/C26H25BrN2O9/c27-11-1-4-17(30)15(9-11)20-12-2-3-13-21(25(37)28(23(13)35)7-5-18(31)32)14(12)10-16-22(20)26(38)29(24(16)36)8-6-19(33)34/h1-2,4,9,13-14,16,20-22,30H,3,5-8,10H2,(H,31,32)(H,33,34) |
| InChIKey | CCUXILCCAWQAHS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|