C32H38N2O9 — CID 6637778
6-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(5-carboxypentyl)-6-(2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 6637778) has the molecular formula C32H38N2O9 and a molecular weight of 594.66 g/mol. Its IUPAC name is 6-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(5-carboxypentyl)-6-(2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(5-carboxypentyl)-6-(2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 6637778 |
| Molecular Formula | C32H38N2O9 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.26 |
| IUPAC Name | 6-[(3aS,6R,6aS,9aR,10aS,10bR)-8-(5-carboxypentyl)-6-(2-hydroxyphenyl)-1,3,7,9-tetraoxo-3a,4,6,6a,9a,10,10a,10b-octahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(CCCCCC(=O)O)C(=O)[C@H]2[C@H]3c2ccccc2O)C1=O |
| InChI | InChI=1S/C32H38N2O9/c35-23-10-6-5-9-19(23)26-18-13-14-20-27(31(42)33(29(20)40)15-7-1-3-11-24(36)37)21(18)17-22-28(26)32(43)34(30(22)41)16-8-2-4-12-25(38)39/h5-6,9-10,13,20-22,26-28,35H,1-4,7-8,11-12,14-17H2,(H,36,37)(H,38,39)/t20-,21+,22+,26+,27-,28+/m0/s1 |
| InChIKey | KQUMFSBSYXKITR-RNFGATJVSA-N |
| XLogP | 3.32 |
| TPSA | 169.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|