C28H26BrNO7 — CID 4191769
6-[9-bromo-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 4191769) has the molecular formula C28H26BrNO7 and a molecular weight of 568.42 g/mol. Its IUPAC name is 6-[9-bromo-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[9-bromo-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4191769 |
| Molecular Formula | C28H26BrNO7 |
| Molecular Weight | 568.42 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | 6-[9-bromo-6-(2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2CC=C3C(c4ccccc4O)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C28H26BrNO7/c29-19-13-21(32)25-18(26(19)35)12-17-14(23(25)15-6-3-4-7-20(15)31)9-10-16-24(17)28(37)30(27(16)36)11-5-1-2-8-22(33)34/h3-4,6-7,9,13,16-17,23-24,31H,1-2,5,8,10-12H2,(H,33,34) |
| InChIKey | HWVZUQHICHUPTJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|