C26H22BrNO8 — CID 4549968
3-[9-bromo-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid (PubChem CID 4549968) has the molecular formula C26H22BrNO8 and a molecular weight of 556.37 g/mol. Its IUPAC name is 3-[9-bromo-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[9-bromo-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 4549968 |
| Molecular Formula | C26H22BrNO8 |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 555.05 |
| IUPAC Name | 3-[9-bromo-6-(2-hydroxy-6-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cccc(O)c1C1C2=CCC3C(=O)N(CCC(=O)O)C(=O)C3C2CC2=C1C(=O)C=C(Br)C2=O |
| InChI | InChI=1S/C26H22BrNO8/c1-36-18-4-2-3-16(29)23(18)22-11-5-6-12-20(26(35)28(25(12)34)8-7-19(31)32)13(11)9-14-21(22)17(30)10-15(27)24(14)33/h2-5,10,12-13,20,22,29H,6-9H2,1H3,(H,31,32) |
| InChIKey | CXDXLNZDYMCZSQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|