C26H21BrFNO7 — CID 6661855
4-[(3aS,6R,11aS,11bR)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 6661855) has the molecular formula C26H21BrFNO7 and a molecular weight of 558.36 g/mol. Its IUPAC name is 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 6661855 |
| Molecular Formula | C26H21BrFNO7 |
| Molecular Weight | 558.36 g/mol |
| Exact Mass | 557.05 |
| IUPAC Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4cccc(F)c4O)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C26H21BrFNO7/c27-16-10-18(30)22-15(23(16)33)9-14-11(20(22)12-3-1-4-17(28)24(12)34)6-7-13-21(14)26(36)29(25(13)35)8-2-5-19(31)32/h1,3-4,6,10,13-14,20-21,34H,2,5,7-9H2,(H,31,32)/t13-,14+,20+,21-/m0/s1 |
| InChIKey | LPXNVKPMSLGCAX-HLNGLMCHSA-N |
| XLogP | 3.16 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|