C28H25BrFNO7 — CID 4165640
6-[9-bromo-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 4165640) has the molecular formula C28H25BrFNO7 and a molecular weight of 586.41 g/mol. Its IUPAC name is 6-[9-bromo-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[9-bromo-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4165640 |
| Molecular Formula | C28H25BrFNO7 |
| Molecular Weight | 586.41 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | 6-[9-bromo-6-(3-fluoro-4-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2CC=C3C(c4ccc(O)c(F)c4)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C28H25BrFNO7/c29-18-12-21(33)25-17(26(18)36)11-16-14(23(25)13-5-8-20(32)19(30)10-13)6-7-15-24(16)28(38)31(27(15)37)9-3-1-2-4-22(34)35/h5-6,8,10,12,15-16,23-24,32H,1-4,7,9,11H2,(H,34,35) |
| InChIKey | IHIQOHFAYXTVOZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.41 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|