C27H26BrNO6 — CID 5049422
9-bromo-6-(3-ethoxy-4-hydroxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5049422) has the molecular formula C27H26BrNO6 and a molecular weight of 540.41 g/mol. Its IUPAC name is 9-bromo-6-(3-ethoxy-4-hydroxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(3-ethoxy-4-hydroxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5049422 |
| Molecular Formula | C27H26BrNO6 |
| Molecular Weight | 540.41 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 9-bromo-6-(3-ethoxy-4-hydroxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCCN1C(=O)C2CC=C3C(c4ccc(O)c(OCC)c4)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C27H26BrNO6/c1-3-9-29-26(33)15-7-6-14-16(23(15)27(29)34)11-17-24(20(31)12-18(28)25(17)32)22(14)13-5-8-19(30)21(10-13)35-4-2/h5-6,8,10,12,15-16,22-23,30H,3-4,7,9,11H2,1-2H3 |
| InChIKey | ZAUOLNFAIRIJDZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|