C26H25NO6 — CID 3602348
6-(3-ethoxy-4-hydroxyphenyl)-2,8-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3602348) has the molecular formula C26H25NO6 and a molecular weight of 447.49 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxyphenyl)-2,8-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(3-ethoxy-4-hydroxyphenyl)-2,8-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3602348 |
| Molecular Formula | C26H25NO6 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxyphenyl)-2,8-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(C)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)ccc1O |
| InChI | InChI=1S/C26H25NO6/c1-4-33-20-10-13(5-8-18(20)28)21-14-6-7-15-22(26(32)27(3)25(15)31)16(14)11-17-19(29)9-12(2)24(30)23(17)21/h5-6,8-10,15-16,21-22,28H,4,7,11H2,1-3H3 |
| InChIKey | PBUBBEYBZWJPGP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|