C25H23NO7 — CID 5000778
6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5000778) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is 6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5000778 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | 6-(3-ethoxy-4-hydroxyphenyl)-2-hydroxy-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCOc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)ccc1O |
| InChI | InChI=1S/C25H23NO7/c1-3-33-19-9-12(4-7-17(19)27)20-13-5-6-14-21(25(31)26(32)24(14)30)15(13)10-16-18(28)8-11(2)23(29)22(16)20/h4-5,7-9,14-15,20-21,27,32H,3,6,10H2,1-2H3 |
| InChIKey | KLIAUUDUCBVZAF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|