C26H25NO7 — CID 3315523
6-(4-hydroxy-3,5-dimethoxyphenyl)-2,9-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3315523) has the molecular formula C26H25NO7 and a molecular weight of 463.49 g/mol. Its IUPAC name is 6-(4-hydroxy-3,5-dimethoxyphenyl)-2,9-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-2,9-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3315523 |
| Molecular Formula | C26H25NO7 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 6-(4-hydroxy-3,5-dimethoxyphenyl)-2,9-dimethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C26H25NO7/c1-11-7-17(28)22-16(23(11)29)10-15-13(5-6-14-21(15)26(32)27(2)25(14)31)20(22)12-8-18(33-3)24(30)19(9-12)34-4/h5,7-9,14-15,20-21,30H,6,10H2,1-4H3 |
| InChIKey | MYKKFBAXOKHBKC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|