C27H26BrNO7 — CID 6662738
(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662738) has the molecular formula C27H26BrNO7 and a molecular weight of 556.41 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662738 |
| Molecular Formula | C27H26BrNO7 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.09 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4cc(OC)c(O)c(OC)c4)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C27H26BrNO7/c1-4-7-29-26(33)14-6-5-13-15(22(14)27(29)34)10-16-23(18(30)11-17(28)24(16)31)21(13)12-8-19(35-2)25(32)20(9-12)36-3/h5,8-9,11,14-15,21-22,32H,4,6-7,10H2,1-3H3/t14-,15+,21-,22-/m0/s1 |
| InChIKey | YCIWUUZAGDOHLA-QQVJTJINSA-N |
| XLogP | 3.58 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|