C25H22BrNO6 — CID 6662395
(3aS,6R,11aS,11bR)-9-bromo-2-ethyl-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662395) has the molecular formula C25H22BrNO6 and a molecular weight of 512.36 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-2-ethyl-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-2-ethyl-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662395 |
| Molecular Formula | C25H22BrNO6 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 511.06 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-2-ethyl-6-(3-hydroxy-4-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccc(OC)c(O)c4)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C25H22BrNO6/c1-3-27-24(31)13-6-5-12-14(21(13)25(27)32)9-15-22(18(29)10-16(26)23(15)30)20(12)11-4-7-19(33-2)17(28)8-11/h4-5,7-8,10,13-14,20-21,28H,3,6,9H2,1-2H3/t13-,14+,20-,21-/m0/s1 |
| InChIKey | QLZNCFSZRQDQKD-ZVLVQXPOSA-N |
| XLogP | 3.18 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|