C27H26ClNO6 — CID 6664296
(3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6664296) has the molecular formula C27H26ClNO6 and a molecular weight of 495.96 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6664296 |
| Molecular Formula | C27H26ClNO6 |
| Molecular Weight | 495.96 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-2-propyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4cc(Cl)c(O)c(OC)c4)C4=C(C[C@H]32)C(=O)C(C)=CC4=O)C1=O |
| InChI | InChI=1S/C27H26ClNO6/c1-4-7-29-26(33)15-6-5-14-16(22(15)27(29)34)11-17-23(19(30)8-12(2)24(17)31)21(14)13-9-18(28)25(32)20(10-13)35-3/h5,8-10,15-16,21-22,32H,4,6-7,11H2,1-3H3/t15-,16+,21-,22-/m0/s1 |
| InChIKey | LOZWBLIVJYMIQR-KFVVBQDRSA-N |
| XLogP | 3.89 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|