C30H25BClNO8 — CID 6664329
[3-[(3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 6664329) has the molecular formula C30H25BClNO8 and a molecular weight of 573.79 g/mol. Its IUPAC name is [3-[(3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 6664329 |
| Molecular Formula | C30H25BClNO8 |
| Molecular Weight | 573.79 g/mol |
| Exact Mass | 573.14 |
| IUPAC Name | [3-[(3aS,6R,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | COc1cc([C@H]2C3=CC[C@@H]4C(=O)N(c5cccc(B(O)O)c5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(C)C3=O)cc(Cl)c1O |
| InChI | InChI=1S/C30H25BClNO8/c1-13-8-22(34)26-20(27(13)35)12-19-17(24(26)14-9-21(32)28(36)23(10-14)41-2)6-7-18-25(19)30(38)33(29(18)37)16-5-3-4-15(11-16)31(39)40/h3-6,8-11,18-19,24-25,36,39-40H,7,12H2,1-2H3/t18-,19+,24-,25-/m0/s1 |
| InChIKey | UKVPTTFSYIOCHH-JHFSOIRNSA-N |
| XLogP | 2.37 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.79 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|