C29H23BFNO7 — CID 6663379
[3-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid (PubChem CID 6663379) has the molecular formula C29H23BFNO7 and a molecular weight of 527.31 g/mol. Its IUPAC name is [3-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid.
| Compound Name | [3-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 6663379 |
| Molecular Formula | C29H23BFNO7 |
| Molecular Weight | 527.31 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | [3-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]phenyl]boronic acid |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5cccc(B(O)O)c5)C(=O)[C@@H]43)[C@@H]2c2cccc(F)c2O)C1=O |
| InChI | InChI=1S/C29H23BFNO7/c1-13-10-22(33)25-20(26(13)34)12-19-16(23(25)17-6-3-7-21(31)27(17)35)8-9-18-24(19)29(37)32(28(18)36)15-5-2-4-14(11-15)30(38)39/h2-8,10-11,18-19,23-24,35,38-39H,9,12H2,1H3/t18-,19+,23+,24-/m0/s1 |
| InChIKey | VVNKWCMCIHPOEI-LUZMIZLMSA-N |
| XLogP | 1.85 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|