C28H18BrFN2O7 — CID 4653904
9-bromo-6-(3-fluoro-2-hydroxyphenyl)-2-(3-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4653904) has the molecular formula C28H18BrFN2O7 and a molecular weight of 593.36 g/mol. Its IUPAC name is 9-bromo-6-(3-fluoro-2-hydroxyphenyl)-2-(3-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(3-fluoro-2-hydroxyphenyl)-2-(3-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4653904 |
| Molecular Formula | C28H18BrFN2O7 |
| Molecular Weight | 593.36 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | 9-bromo-6-(3-fluoro-2-hydroxyphenyl)-2-(3-nitrophenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1C(c1cccc(F)c1O)C1=CCC3C(=O)N(c4cccc([N+](=O)[O-])c4)C(=O)C3C1C2 |
| InChI | InChI=1S/C28H18BrFN2O7/c29-19-11-21(33)24-18(25(19)34)10-17-14(22(24)15-5-2-6-20(30)26(15)35)7-8-16-23(17)28(37)31(27(16)36)12-3-1-4-13(9-12)32(38)39/h1-7,9,11,16-17,22-23,35H,8,10H2 |
| InChIKey | VNWXLVWJWSVMEH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 134.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|