C34H24BrFN2O5 — CID 5169569
2-(4-anilinophenyl)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5169569) has the molecular formula C34H24BrFN2O5 and a molecular weight of 639.48 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5169569 |
| Molecular Formula | C34H24BrFN2O5 |
| Molecular Weight | 639.48 g/mol |
| Exact Mass | 638.09 |
| IUPAC Name | 2-(4-anilinophenyl)-9-bromo-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1C(c1cccc(F)c1O)C1=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C1C2 |
| InChI | InChI=1S/C34H24BrFN2O5/c35-25-16-27(39)30-24(31(25)40)15-23-20(28(30)21-7-4-8-26(36)32(21)41)13-14-22-29(23)34(43)38(33(22)42)19-11-9-18(10-12-19)37-17-5-2-1-3-6-17/h1-13,16,22-23,28-29,37,41H,14-15H2 |
| InChIKey | ONASSCUYZGQKSG-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|