C35H27BrN2O5 — CID 6662193
(3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(2-hydroxy-3-methylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662193) has the molecular formula C35H27BrN2O5 and a molecular weight of 635.51 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(2-hydroxy-3-methylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(2-hydroxy-3-methylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662193 |
| Molecular Formula | C35H27BrN2O5 |
| Molecular Weight | 635.51 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(2-hydroxy-3-methylphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | Cc1cccc([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C35H27BrN2O5/c1-18-6-5-9-23(32(18)40)29-22-14-15-24-30(25(22)16-26-31(29)28(39)17-27(36)33(26)41)35(43)38(34(24)42)21-12-10-20(11-13-21)37-19-7-3-2-4-8-19/h2-14,17,24-25,29-30,37,40H,15-16H2,1H3/t24-,25+,29+,30-/m0/s1 |
| InChIKey | HVYHIDPGXZEHFB-CYZBZIJESA-N |
| XLogP | 6.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|