C35H24BrF3N2O6 — CID 4101183
2-(4-anilinophenyl)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4101183) has the molecular formula C35H24BrF3N2O6 and a molecular weight of 705.48 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4101183 |
| Molecular Formula | C35H24BrF3N2O6 |
| Molecular Weight | 705.48 g/mol |
| Exact Mass | 704.08 |
| IUPAC Name | 2-(4-anilinophenyl)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1C(c1cc(OC(F)(F)F)ccc1O)C1=CCC3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)C3C1C2 |
| InChI | InChI=1S/C35H24BrF3N2O6/c36-26-16-28(43)31-25(32(26)44)15-23-21(29(31)24-14-20(10-13-27(24)42)47-35(37,38)39)11-12-22-30(23)34(46)41(33(22)45)19-8-6-18(7-9-19)40-17-4-2-1-3-5-17/h1-11,13-14,16,22-23,29-30,40,42H,12,15H2 |
| InChIKey | PUCLWDOZYFAPDS-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.48 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|