C30H19BrF3NO8 — CID 6662240
3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 6662240) has the molecular formula C30H19BrF3NO8 and a molecular weight of 658.38 g/mol. Its IUPAC name is 3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6662240 |
| Molecular Formula | C30H19BrF3NO8 |
| Molecular Weight | 658.38 g/mol |
| Exact Mass | 657.02 |
| IUPAC Name | 3-[(3aS,6R,11aS,11bR)-9-bromo-6-[2-hydroxy-5-(trifluoromethoxy)phenyl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1cc(OC(F)(F)F)ccc1O)C1=CC[C@@H]3C(=O)N(c4cccc(C(=O)O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C30H19BrF3NO8/c31-20-11-22(37)25-19(26(20)38)10-17-15(23(25)18-9-14(4-7-21(18)36)43-30(32,33)34)5-6-16-24(17)28(40)35(27(16)39)13-3-1-2-12(8-13)29(41)42/h1-5,7-9,11,16-17,23-24,36H,6,10H2,(H,41,42)/t16-,17+,23+,24-/m0/s1 |
| InChIKey | RJBJKXYGQRXHQT-GVAOLFSASA-N |
| XLogP | 4.96 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|