C33H22BrNO7 — CID 6663190
3-[(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 6663190) has the molecular formula C33H22BrNO7 and a molecular weight of 624.44 g/mol. Its IUPAC name is 3-[(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6663190 |
| Molecular Formula | C33H22BrNO7 |
| Molecular Weight | 624.44 g/mol |
| Exact Mass | 623.06 |
| IUPAC Name | 3-[(3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1c(O)ccc3ccccc13)C1=CC[C@@H]3C(=O)N(c4cccc(C(=O)O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C33H22BrNO7/c34-23-14-25(37)28-22(30(23)38)13-21-19(29(28)27-18-7-2-1-4-15(18)8-11-24(27)36)9-10-20-26(21)32(40)35(31(20)39)17-6-3-5-16(12-17)33(41)42/h1-9,11-12,14,20-21,26,29,36H,10,13H2,(H,41,42)/t20-,21+,26-,29+/m0/s1 |
| InChIKey | IUJBIJOPDMKJFJ-BBACSAFPSA-N |
| XLogP | 5.21 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|