C34H25NO7 — CID 3406472
3-[6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 3406472) has the molecular formula C34H25NO7 and a molecular weight of 559.57 g/mol. Its IUPAC name is 3-[6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3406472 |
| Molecular Formula | C34H25NO7 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 3-[6-(4-hydroxynaphthalen-1-yl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | CC1=CC(=O)C2=C(C1=O)C(c1ccc(O)c3ccccc13)C1=CCC3C(=O)N(c4cccc(C(=O)O)c4)C(=O)C3C1C2 |
| InChI | InChI=1S/C34H25NO7/c1-16-13-27(37)25-15-24-22(28(30(25)31(16)38)21-11-12-26(36)20-8-3-2-7-19(20)21)9-10-23-29(24)33(40)35(32(23)39)18-6-4-5-17(14-18)34(41)42/h2-9,11-14,23-24,28-29,36H,10,15H2,1H3,(H,41,42) |
| InChIKey | LVBAGYMQIGTSPN-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|