C32H27NO7 — CID 6665660
3-[(3aS,6R,11aS,11bR)-6-(4-hydroxy-3,5-dimethylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 6665660) has the molecular formula C32H27NO7 and a molecular weight of 537.57 g/mol. Its IUPAC name is 3-[(3aS,6R,11aS,11bR)-6-(4-hydroxy-3,5-dimethylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[(3aS,6R,11aS,11bR)-6-(4-hydroxy-3,5-dimethylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6665660 |
| Molecular Formula | C32H27NO7 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | 3-[(3aS,6R,11aS,11bR)-6-(4-hydroxy-3,5-dimethylphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1cc(C)c(O)c(C)c1)C1=CC[C@@H]3C(=O)N(c4cccc(C(=O)O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C32H27NO7/c1-14-9-18(10-15(2)28(14)35)25-20-7-8-21-26(22(20)13-23-24(34)11-16(3)29(36)27(23)25)31(38)33(30(21)37)19-6-4-5-17(12-19)32(39)40/h4-7,9-12,21-22,25-26,35H,8,13H2,1-3H3,(H,39,40)/t21-,22+,25-,26-/m0/s1 |
| InChIKey | LLUFLVLGKUCZMP-DDOAZUFRSA-N |
| XLogP | 4.34 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|