C31H24BrNO8 — CID 6662621
4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 6662621) has the molecular formula C31H24BrNO8 and a molecular weight of 618.44 g/mol. Its IUPAC name is 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6662621 |
| Molecular Formula | C31H24BrNO8 |
| Molecular Weight | 618.44 g/mol |
| Exact Mass | 617.07 |
| IUPAC Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxy-3,5-dimethylphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | Cc1cc([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(Br)C3=O)cc(C)c1O |
| InChI | InChI=1S/C31H24BrNO8/c1-12-7-14(8-13(2)27(12)36)24-16-5-6-18-25(19(16)10-20-26(24)23(35)11-21(32)28(20)37)30(39)33(29(18)38)15-3-4-17(31(40)41)22(34)9-15/h3-5,7-9,11,18-19,24-25,34,36H,6,10H2,1-2H3,(H,40,41)/t18-,19+,24-,25-/m0/s1 |
| InChIKey | VTMALODFWGAEPZ-JHFSOIRNSA-N |
| XLogP | 4.38 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|