C31H23Br2NO9 — CID 6664483
4-[(3aS,6S,11aS,11bR)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 6664483) has the molecular formula C31H23Br2NO9 and a molecular weight of 713.33 g/mol. Its IUPAC name is 4-[(3aS,6S,11aS,11bR)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3aS,6S,11aS,11bR)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6664483 |
| Molecular Formula | C31H23Br2NO9 |
| Molecular Weight | 713.33 g/mol |
| Exact Mass | 710.97 |
| IUPAC Name | 4-[(3aS,6S,11aS,11bR)-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | COc1cc([C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(C)C3=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C31H23Br2NO9/c1-11-7-20(36)24-18(27(11)37)9-16-13(22(24)17-10-21(43-2)28(38)26(33)25(17)32)5-6-15-23(16)30(40)34(29(15)39)12-3-4-14(31(41)42)19(35)8-12/h3-5,7-8,10,15-16,22-23,35,38H,6,9H2,1-2H3,(H,41,42)/t15-,16+,22+,23-/m0/s1 |
| InChIKey | PVGWUWWDZQWBDB-FTJWQGMPSA-N |
| XLogP | 4.96 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|