C30H22ClNO8 — CID 6664065
4-[(3aS,6S,11aS,11bR)-6-(2-chloro-4-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 6664065) has the molecular formula C30H22ClNO8 and a molecular weight of 559.96 g/mol. Its IUPAC name is 4-[(3aS,6S,11aS,11bR)-6-(2-chloro-4-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3aS,6S,11aS,11bR)-6-(2-chloro-4-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6664065 |
| Molecular Formula | C30H22ClNO8 |
| Molecular Weight | 559.96 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 4-[(3aS,6S,11aS,11bR)-6-(2-chloro-4-hydroxyphenyl)-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)[C@@H]43)[C@@H]2c2ccc(O)cc2Cl)C1=O |
| InChI | InChI=1S/C30H22ClNO8/c1-12-8-23(35)26-20(27(12)36)11-19-15(24(26)16-5-3-14(33)10-21(16)31)6-7-18-25(19)29(38)32(28(18)37)13-2-4-17(30(39)40)22(34)9-13/h2-6,8-10,18-19,24-25,33-34H,7,11H2,1H3,(H,39,40)/t18-,19+,24+,25-/m0/s1 |
| InChIKey | ICXOBSZMVVHMSM-MKTUGGFXSA-N |
| XLogP | 4.08 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|