C24H19Br2NO7 — CID 3675631
6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3675631) has the molecular formula C24H19Br2NO7 and a molecular weight of 593.22 g/mol. Its IUPAC name is 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3675631 |
| Molecular Formula | C24H19Br2NO7 |
| Molecular Weight | 593.22 g/mol |
| Exact Mass | 590.95 |
| IUPAC Name | 6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-2-hydroxy-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(O)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C24H19Br2NO7/c1-8-5-14(28)18-13(21(8)29)6-11-9(3-4-10-17(11)24(32)27(33)23(10)31)16(18)12-7-15(34-2)22(30)20(26)19(12)25/h3,5,7,10-11,16-17,30,33H,4,6H2,1-2H3 |
| InChIKey | OBJPNWMXIMSELX-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|