C32H22BrF6NO6 — CID 3435736
2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxy-3-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3435736) has the molecular formula C32H22BrF6NO6 and a molecular weight of 710.42 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxy-3-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxy-3-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3435736 |
| Molecular Formula | C32H22BrF6NO6 |
| Molecular Weight | 710.42 g/mol |
| Exact Mass | 709.05 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxy-3-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(Br)cc(C2C3=CCC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)c1O |
| InChI | InChI=1S/C32H22BrF6NO6/c1-12-5-22(41)26-21(27(12)42)11-19-17(24(26)20-9-15(33)10-23(46-2)28(20)43)3-4-18-25(19)30(45)40(29(18)44)16-7-13(31(34,35)36)6-14(8-16)32(37,38)39/h3,5-10,18-19,24-25,43H,4,11H2,1-2H3 |
| InChIKey | HULDWLDBWXFLAD-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|