C31H20BrF6NO5 — CID 6663542
(3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6663542) has the molecular formula C31H20BrF6NO5 and a molecular weight of 680.40 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6663542 |
| Molecular Formula | C31H20BrF6NO5 |
| Molecular Weight | 680.40 g/mol |
| Exact Mass | 679.04 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(5-bromo-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C[C@@H]3C(=CC[C@@H]4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)[C@@H]43)[C@@H]2c2cc(Br)ccc2O)C1=O |
| InChI | InChI=1S/C31H20BrF6NO5/c1-12-6-23(41)26-21(27(12)42)11-19-17(24(26)20-10-15(32)2-5-22(20)40)3-4-18-25(19)29(44)39(28(18)43)16-8-13(30(33,34)35)7-14(9-16)31(36,37)38/h2-3,5-10,18-19,24-25,40H,4,11H2,1H3/t18-,19+,24+,25-/m0/s1 |
| InChIKey | CZRDOSDKHMGTRJ-MKTUGGFXSA-N |
| XLogP | 6.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.40 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|