C32H23F6NO6 — CID 6665670
(3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6665670) has the molecular formula C32H23F6NO6 and a molecular weight of 631.53 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6665670 |
| Molecular Formula | C32H23F6NO6 |
| Molecular Weight | 631.53 g/mol |
| Exact Mass | 631.14 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-[3,5-bis(trifluoromethyl)phenyl]-6-(4-hydroxy-2-methoxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)ccc1[C@H]1C2=CC[C@@H]3C(=O)N(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(=O)[C@@H]3[C@@H]2CC2=C1C(=O)C(C)=CC2=O |
| InChI | InChI=1S/C32H23F6NO6/c1-13-7-23(41)22-12-21-18(25(27(22)28(13)42)19-4-3-17(40)11-24(19)45-2)5-6-20-26(21)30(44)39(29(20)43)16-9-14(31(33,34)35)8-15(10-16)32(36,37)38/h3-5,7-11,20-21,25-26,40H,6,12H2,1-2H3/t20-,21+,25+,26-/m0/s1 |
| InChIKey | QXHXMHIWWYGMIH-MZFMZNHHSA-N |
| XLogP | 6.07 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|