C31H21F6NO5 — CID 4180433
2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4180433) has the molecular formula C31H21F6NO5 and a molecular weight of 601.50 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4180433 |
| Molecular Formula | C31H21F6NO5 |
| Molecular Weight | 601.50 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-hydroxyphenyl)-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(C1=O)C(c1cccc(O)c1)C1=CCC3C(=O)N(c4cc(C(F)(F)F)cc(C(F)(F)F)c4)C(=O)C3C1C2 |
| InChI | InChI=1S/C31H21F6NO5/c1-13-7-23(40)22-12-21-19(24(26(22)27(13)41)14-3-2-4-18(39)8-14)5-6-20-25(21)29(43)38(28(20)42)17-10-15(30(32,33)34)9-16(11-17)31(35,36)37/h2-5,7-11,20-21,24-25,39H,6,12H2,1H3 |
| InChIKey | BZBZUEFRVUGKGA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|