C28H28BrNO6 — CID 4278157
6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-tert-butyl-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4278157) has the molecular formula C28H28BrNO6 and a molecular weight of 554.44 g/mol. Its IUPAC name is 6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-tert-butyl-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-tert-butyl-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4278157 |
| Molecular Formula | C28H28BrNO6 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 6-(3-bromo-4-hydroxy-5-methoxyphenyl)-2-tert-butyl-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)cc(Br)c1O |
| InChI | InChI=1S/C28H28BrNO6/c1-12-8-19(31)23-17(24(12)32)11-16-14(21(23)13-9-18(29)25(33)20(10-13)36-5)6-7-15-22(16)27(35)30(26(15)34)28(2,3)4/h6,8-10,15-16,21-22,33H,7,11H2,1-5H3 |
| InChIKey | RDIYNAVNJVXBIT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|