C28H27Br2NO6 — CID 4204926
2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4204926) has the molecular formula C28H27Br2NO6 and a molecular weight of 633.33 g/mol. Its IUPAC name is 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4204926 |
| Molecular Formula | C28H27Br2NO6 |
| Molecular Weight | 633.33 g/mol |
| Exact Mass | 631.02 |
| IUPAC Name | 2-tert-butyl-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C28H27Br2NO6/c1-11-8-17(32)21-16(24(11)33)9-14-12(19(21)15-10-18(37-5)25(34)23(30)22(15)29)6-7-13-20(14)27(36)31(26(13)35)28(2,3)4/h6,8,10,13-14,19-20,34H,7,9H2,1-5H3 |
| InChIKey | GZKDLESYZLMPNU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.33 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|