C27H26ClNO5 — CID 3487473
2-tert-butyl-6-(5-chloro-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3487473) has the molecular formula C27H26ClNO5 and a molecular weight of 479.96 g/mol. Its IUPAC name is 2-tert-butyl-6-(5-chloro-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-tert-butyl-6-(5-chloro-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3487473 |
| Molecular Formula | C27H26ClNO5 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-tert-butyl-6-(5-chloro-2-hydroxyphenyl)-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC1=CC(=O)C2=C(CC3C(=CCC4C(=O)N(C(C)(C)C)C(=O)C43)C2c2cc(Cl)ccc2O)C1=O |
| InChI | InChI=1S/C27H26ClNO5/c1-12-9-20(31)23-18(24(12)32)11-16-14(21(23)17-10-13(28)5-8-19(17)30)6-7-15-22(16)26(34)29(25(15)33)27(2,3)4/h5-6,8-10,15-16,21-22,30H,7,11H2,1-4H3 |
| InChIKey | YUMFHTYGYLZSBP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|