C33H22BrNO8 — CID 6663267
4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 6663267) has the molecular formula C33H22BrNO8 and a molecular weight of 640.44 g/mol. Its IUPAC name is 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 6663267 |
| Molecular Formula | C33H22BrNO8 |
| Molecular Weight | 640.44 g/mol |
| Exact Mass | 639.05 |
| IUPAC Name | 4-[(3aS,6R,11aS,11bR)-9-bromo-6-(4-hydroxynaphthalen-1-yl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1ccc(O)c3ccccc13)C1=CC[C@@H]3C(=O)N(c4ccc(C(=O)O)c(O)c4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C33H22BrNO8/c34-23-13-26(38)29-22(30(23)39)12-21-18(27(29)17-9-10-24(36)16-4-2-1-3-15(16)17)7-8-20-28(21)32(41)35(31(20)40)14-5-6-19(33(42)43)25(37)11-14/h1-7,9-11,13,20-21,27-28,36-37H,8,12H2,(H,42,43)/t20-,21+,27-,28-/m0/s1 |
| InChIKey | OSGGKNZBKYXSBS-HHPBIKOWSA-N |
| XLogP | 4.92 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|