C34H24Br2N2O5 — CID 6662041
(3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6662041) has the molecular formula C34H24Br2N2O5 and a molecular weight of 700.38 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6662041 |
| Molecular Formula | C34H24Br2N2O5 |
| Molecular Weight | 700.38 g/mol |
| Exact Mass | 698.01 |
| IUPAC Name | (3aS,6R,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-(5-bromo-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1cc(Br)ccc1O)C1=CC[C@@H]3C(=O)N(c4ccc(Nc5ccccc5)cc4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C34H24Br2N2O5/c35-17-6-13-27(39)24(14-17)29-21-11-12-22-30(23(21)15-25-31(29)28(40)16-26(36)32(25)41)34(43)38(33(22)42)20-9-7-19(8-10-20)37-18-4-2-1-3-5-18/h1-11,13-14,16,22-23,29-30,37,39H,12,15H2/t22-,23+,29+,30-/m0/s1 |
| InChIKey | RJGGWKJPCBNFQT-KWMMTJNNSA-N |
| XLogP | 6.86 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.38 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|