C36H29BrN2O7 — CID 3472603
2-(4-anilinophenyl)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3472603) has the molecular formula C36H29BrN2O7 and a molecular weight of 681.54 g/mol. Its IUPAC name is 2-(4-anilinophenyl)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-anilinophenyl)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3472603 |
| Molecular Formula | C36H29BrN2O7 |
| Molecular Weight | 681.54 g/mol |
| Exact Mass | 680.12 |
| IUPAC Name | 2-(4-anilinophenyl)-9-bromo-6-(4-hydroxy-3,5-dimethoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C36H29BrN2O7/c1-45-28-14-18(15-29(46-2)34(28)42)30-22-12-13-23-31(24(22)16-25-32(30)27(40)17-26(37)33(25)41)36(44)39(35(23)43)21-10-8-20(9-11-21)38-19-6-4-3-5-7-19/h3-12,14-15,17,23-24,30-31,38,42H,13,16H2,1-2H3 |
| InChIKey | WVGWYRDHRNZFEW-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|