C38H31BrN2O7 — CID 6663029
(3aS,6S,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6663029) has the molecular formula C38H31BrN2O7 and a molecular weight of 707.58 g/mol. Its IUPAC name is (3aS,6S,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6S,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6663029 |
| Molecular Formula | C38H31BrN2O7 |
| Molecular Weight | 707.58 g/mol |
| Exact Mass | 706.13 |
| IUPAC Name | (3aS,6S,11aS,11bR)-2-(4-anilinophenyl)-9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=C[C@H]2C3=CC[C@@H]4C(=O)N(c5ccc(Nc6ccccc6)cc5)C(=O)[C@@H]4[C@@H]3CC3=C2C(=O)C=C(Br)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C38H31BrN2O7/c1-47-31-16-20(17-32(48-2)36(31)44)8-13-25-24-14-15-26-34(27(24)18-28-33(25)30(42)19-29(39)35(28)43)38(46)41(37(26)45)23-11-9-22(10-12-23)40-21-6-4-3-5-7-21/h3-14,16-17,19,25-27,34,40,44H,15,18H2,1-2H3/t25-,26-,27+,34-/m0/s1 |
| InChIKey | GZBGDWILIPWEOE-ZUDLYUOYSA-N |
| XLogP | 6.67 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.58 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|