C27H24BrNO7 — CID 4575840
9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4575840) has the molecular formula C27H24BrNO7 and a molecular weight of 554.39 g/mol. Its IUPAC name is 9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4575840 |
| Molecular Formula | C27H24BrNO7 |
| Molecular Weight | 554.39 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | 9-bromo-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-2-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(C)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C27H24BrNO7/c1-29-26(33)15-7-6-13-14(5-4-12-8-20(35-2)25(32)21(9-12)36-3)22-17(10-16(13)23(15)27(29)34)24(31)18(28)11-19(22)30/h4-6,8-9,11,14-16,23,32H,7,10H2,1-3H3 |
| InChIKey | CVRKGPGPRMAZGU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|