C32H29NO7S — CID 4591347
6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4591347) has the molecular formula C32H29NO7S and a molecular weight of 571.65 g/mol. Its IUPAC name is 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4591347 |
| Molecular Formula | C32H29NO7S |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(Cc5cccs5)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C32H29NO7S/c1-16-11-24(34)27-20(7-6-17-12-25(39-2)30(36)26(13-17)40-3)19-8-9-21-28(22(19)14-23(27)29(16)35)32(38)33(31(21)37)15-18-5-4-10-41-18/h4-8,10-13,20-22,28,36H,9,14-15H2,1-3H3 |
| InChIKey | WQFOOAHGWHQKDO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|