C33H28BrNO7 — CID 5101170
2-(4-bromophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5101170) has the molecular formula C33H28BrNO7 and a molecular weight of 630.49 g/mol. Its IUPAC name is 2-(4-bromophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-bromophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5101170 |
| Molecular Formula | C33H28BrNO7 |
| Molecular Weight | 630.49 g/mol |
| Exact Mass | 629.10 |
| IUPAC Name | 2-(4-bromophenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(c5ccc(Br)cc5)C(=O)C4C3CC3=C2C(=O)C=C(C)C3=O)cc(OC)c1O |
| InChI | InChI=1S/C33H28BrNO7/c1-16-12-25(36)28-21(9-4-17-13-26(41-2)31(38)27(14-17)42-3)20-10-11-22-29(23(20)15-24(28)30(16)37)33(40)35(32(22)39)19-7-5-18(34)6-8-19/h4-10,12-14,21-23,29,38H,11,15H2,1-3H3 |
| InChIKey | HDJWEOGCGHYMFA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.49 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|