C35H33NO7 — CID 3460187
2-(4-ethylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3460187) has the molecular formula C35H33NO7 and a molecular weight of 579.65 g/mol. Its IUPAC name is 2-(4-ethylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-(4-ethylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3460187 |
| Molecular Formula | C35H33NO7 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.23 |
| IUPAC Name | 2-(4-ethylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-9-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCc1ccc(N2C(=O)C3CC=C4C(C=Cc5cc(OC)c(O)c(OC)c5)C5=C(CC4C3C2=O)C(=O)C(C)=CC5=O)cc1 |
| InChI | InChI=1S/C35H33NO7/c1-5-19-6-9-21(10-7-19)36-34(40)24-13-12-22-23(11-8-20-15-28(42-3)33(39)29(16-20)43-4)30-26(17-25(22)31(24)35(36)41)32(38)18(2)14-27(30)37/h6-12,14-16,23-25,31,39H,5,13,17H2,1-4H3 |
| InChIKey | PDCUKSRBIMYZEV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|