C40H31BrN4O5 — CID 5000774
9-bromo-2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5000774) has the molecular formula C40H31BrN4O5 and a molecular weight of 727.62 g/mol. Its IUPAC name is 9-bromo-2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5000774 |
| Molecular Formula | C40H31BrN4O5 |
| Molecular Weight | 727.62 g/mol |
| Exact Mass | 726.15 |
| IUPAC Name | 9-bromo-2-[4-[[4-(dimethylamino)phenyl]diazenyl]phenyl]-6-(4-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(N3C(=O)C4CC=C5C(c6ccc(O)c7ccccc67)C6=C(CC5C4C3=O)C(=O)C(Br)=CC6=O)cc2)cc1 |
| InChI | InChI=1S/C40H31BrN4O5/c1-44(2)23-11-7-21(8-12-23)42-43-22-9-13-24(14-10-22)45-39(49)29-16-15-28-30(36(29)40(45)50)19-31-37(34(47)20-32(41)38(31)48)35(28)27-17-18-33(46)26-6-4-3-5-25(26)27/h3-15,17-18,20,29-30,35-36,46H,16,19H2,1-2H3/b43-42+ |
| InChIKey | QPNNAOQVXVVSLG-HBSCQBRPSA-N |
| XLogP | 7.99 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.62 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|